About N-butyl-5-methoxy-1,5-dimethylcyclohex-2-en-1-amine
N-butyl-5-methoxy-1,5-dimethylcyclohex-2-en-1-amine (PubChem CID 67926724) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is N-butyl-5-methoxy-1,5-dimethylcyclohex-2-en-1-amine.
Molecular Properties
| Compound Name | N-butyl-5-methoxy-1,5-dimethylcyclohex-2-en-1-amine |
| PubChem CID | 67926724 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | N-butyl-5-methoxy-1,5-dimethylcyclohex-2-en-1-amine |
| SMILES | CCCCNC1(C)C=CCC(C)(OC)C1 |
| InChI | InChI=1S/C13H25NO/c1-5-6-10-14-12(2)8-7-9-13(3,11-12)15-4/h7-8,14H,5-6,9-11H2,1-4H3 |
| InChIKey | UXDYSBZVBJMWOH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-5-methoxy-1,5-dimethylcyclohex-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-5-methoxy-1,5-dimethylcyclohex-2-en-1-amine?
The IUPAC name of N-butyl-5-methoxy-1,5-dimethylcyclohex-2-en-1-amine (CID 67926724) is N-butyl-5-methoxy-1,5-dimethylcyclohex-2-en-1-amine.
What is the SMILES notation for N-butyl-5-methoxy-1,5-dimethylcyclohex-2-en-1-amine?
The canonical SMILES for N-butyl-5-methoxy-1,5-dimethylcyclohex-2-en-1-amine is CCCCNC1(C)C=CCC(C)(OC)C1.
What is the InChIKey of N-butyl-5-methoxy-1,5-dimethylcyclohex-2-en-1-amine?
The InChIKey is UXDYSBZVBJMWOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO/c1-5-6-10-14-12(2)8-7-9-13(3,11-12)15-4/h7-8,14H,5-6,9-11H2,1-4H3.
What are the key properties of N-butyl-5-methoxy-1,5-dimethylcyclohex-2-en-1-amine?
N-butyl-5-methoxy-1,5-dimethylcyclohex-2-en-1-amine has a molecular weight of 211.35 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-5-methoxy-1,5-dimethylcyclohex-2-en-1-amine is sourced from PubChem (CID 67926724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).