C13H27N3O — CID 67926945
3,3,5,5-tetramethyl-1-[2-(propylamino)ethyl]piperazin-2-one (PubChem CID 67926945) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-1-[2-(propylamino)ethyl]piperazin-2-one.
| Compound Name | 3,3,5,5-tetramethyl-1-[2-(propylamino)ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 67926945 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 3,3,5,5-tetramethyl-1-[2-(propylamino)ethyl]piperazin-2-one |
| SMILES | CCCNCCN1CC(C)(C)NC(C)(C)C1=O |
| InChI | InChI=1S/C13H27N3O/c1-6-7-14-8-9-16-10-12(2,3)15-13(4,5)11(16)17/h14-15H,6-10H2,1-5H3 |
| InChIKey | WVZCGFNSKKNRJA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|