About 2-benzyl-1H-imidazole;ethenyl(diphenyl)borane
2-benzyl-1H-imidazole;ethenyl(diphenyl)borane (PubChem CID 67927097) has the molecular formula C24H23BN2
and a molecular weight of 350.27 g/mol. Its IUPAC name is 2-benzyl-1H-imidazole;ethenyl(diphenyl)borane.
Molecular Properties
| Compound Name | 2-benzyl-1H-imidazole;ethenyl(diphenyl)borane |
| PubChem CID | 67927097 |
| Molecular Formula | C24H23BN2 |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-benzyl-1H-imidazole;ethenyl(diphenyl)borane |
| SMILES | C=CB(c1ccccc1)c1ccccc1.c1ccc(Cc2ncc[nH]2)cc1 |
| InChI | InChI=1S/C14H13B.C10H10N2/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-2-4-9(5-3-1)8-10-11-6-7-12-10/h2-12H,1H2;1-7H,8H2,(H,11,12) |
| InChIKey | GYYKMLIMPICZBM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-1H-imidazole;ethenyl(diphenyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1H-imidazole;ethenyl(diphenyl)borane?
The IUPAC name of 2-benzyl-1H-imidazole;ethenyl(diphenyl)borane (CID 67927097) is 2-benzyl-1H-imidazole;ethenyl(diphenyl)borane.
What is the SMILES notation for 2-benzyl-1H-imidazole;ethenyl(diphenyl)borane?
The canonical SMILES for 2-benzyl-1H-imidazole;ethenyl(diphenyl)borane is C=CB(c1ccccc1)c1ccccc1.c1ccc(Cc2ncc[nH]2)cc1.
What is the InChIKey of 2-benzyl-1H-imidazole;ethenyl(diphenyl)borane?
The InChIKey is GYYKMLIMPICZBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13B.C10H10N2/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-2-4-9(5-3-1)8-10-11-6-7-12-10/h2-12H,1H2;1-7H,8H2,(H,11,12).
What are the key properties of 2-benzyl-1H-imidazole;ethenyl(diphenyl)borane?
2-benzyl-1H-imidazole;ethenyl(diphenyl)borane has a molecular weight of 350.27 g/mol, XLogP of 4.02, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1H-imidazole;ethenyl(diphenyl)borane is sourced from PubChem (CID 67927097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).