C30H44BF3N2OS2 — CID 67927108
bis(4-tert-butylthiophen-2-yl)-(5,5,5-trifluoropent-3-enyl)borane;1-(4-methylpentoxy)imidazole (PubChem CID 67927108) has the molecular formula C30H44BF3N2OS2 and a molecular weight of 580.64 g/mol. Its IUPAC name is bis(4-tert-butylthiophen-2-yl)-(5,5,5-trifluoropent-3-enyl)borane;1-(4-methylpentoxy)imidazole.
| Compound Name | bis(4-tert-butylthiophen-2-yl)-(5,5,5-trifluoropent-3-enyl)borane;1-(4-methylpentoxy)imidazole |
|---|---|
| PubChem CID | 67927108 |
| Molecular Formula | C30H44BF3N2OS2 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | bis(4-tert-butylthiophen-2-yl)-(5,5,5-trifluoropent-3-enyl)borane;1-(4-methylpentoxy)imidazole |
| SMILES | CC(C)(C)c1csc(B(CCC=CC(F)(F)F)c2cc(C(C)(C)C)cs2)c1.CC(C)CCCOn1ccnc1 |
| InChI | InChI=1S/C21H28BF3S2.C9H16N2O/c1-19(2,3)15-11-17(26-13-15)22(10-8-7-9-21(23,24)25)18-12-16(14-27-18)20(4,5)6;1-9(2)4-3-7-12-11-6-5-10-8-11/h7,9,11-14H,8,10H2,1-6H3;5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | QKSVMQLHXFKFOJ-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|