About diphenyl(5,5,5-trifluoropent-3-enyl)borane;1-(methoxymethyl)imidazole
diphenyl(5,5,5-trifluoropent-3-enyl)borane;1-(methoxymethyl)imidazole (PubChem CID 67927157) has the molecular formula C22H24BF3N2O
and a molecular weight of 400.25 g/mol. Its IUPAC name is diphenyl(5,5,5-trifluoropent-3-enyl)borane;1-(methoxymethyl)imidazole.
Molecular Properties
| Compound Name | diphenyl(5,5,5-trifluoropent-3-enyl)borane;1-(methoxymethyl)imidazole |
| PubChem CID | 67927157 |
| Molecular Formula | C22H24BF3N2O |
| Molecular Weight | 400.25 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | diphenyl(5,5,5-trifluoropent-3-enyl)borane;1-(methoxymethyl)imidazole |
| SMILES | COCn1ccnc1.FC(F)(F)C=CCCB(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H16BF3.C5H8N2O/c19-17(20,21)13-7-8-14-18(15-9-3-1-4-10-15)16-11-5-2-6-12-16;1-8-5-7-3-2-6-4-7/h1-7,9-13H,8,14H2;2-4H,5H2,1H3 |
| InChIKey | ZMMMMUBCWOPPTM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze diphenyl(5,5,5-trifluoropent-3-enyl)borane;1-(methoxymethyl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl(5,5,5-trifluoropent-3-enyl)borane;1-(methoxymethyl)imidazole?
The IUPAC name of diphenyl(5,5,5-trifluoropent-3-enyl)borane;1-(methoxymethyl)imidazole (CID 67927157) is diphenyl(5,5,5-trifluoropent-3-enyl)borane;1-(methoxymethyl)imidazole.
What is the SMILES notation for diphenyl(5,5,5-trifluoropent-3-enyl)borane;1-(methoxymethyl)imidazole?
The canonical SMILES for diphenyl(5,5,5-trifluoropent-3-enyl)borane;1-(methoxymethyl)imidazole is COCn1ccnc1.FC(F)(F)C=CCCB(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenyl(5,5,5-trifluoropent-3-enyl)borane;1-(methoxymethyl)imidazole?
The InChIKey is ZMMMMUBCWOPPTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16BF3.C5H8N2O/c19-17(20,21)13-7-8-14-18(15-9-3-1-4-10-15)16-11-5-2-6-12-16;1-8-5-7-3-2-6-4-7/h1-7,9-13H,8,14H2;2-4H,5H2,1H3.
What are the key properties of diphenyl(5,5,5-trifluoropent-3-enyl)borane;1-(methoxymethyl)imidazole?
diphenyl(5,5,5-trifluoropent-3-enyl)borane;1-(methoxymethyl)imidazole has a molecular weight of 400.25 g/mol, XLogP of 4.29, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl(5,5,5-trifluoropent-3-enyl)borane;1-(methoxymethyl)imidazole is sourced from PubChem (CID 67927157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).