About CID 67927486
CID 67927486 (PubChem CID 67927486) has the molecular formula C26H32BClF3N2
and a molecular weight of 475.82 g/mol.
Molecular Properties
| Compound Name | CID 67927486 |
| PubChem CID | 67927486 |
| Molecular Formula | C26H32BClF3N2 |
| Molecular Weight | 475.82 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | — |
| SMILES | CCCCCCCCn1cncc1C.FC(F)(F)c1cccc(C[B]c2ccccc2Cl)c1 |
| InChI | InChI=1S/C14H10BClF3.C12H22N2/c16-13-7-2-1-6-12(13)15-9-10-4-3-5-11(8-10)14(17,18)19;1-3-4-5-6-7-8-9-14-11-13-10-12(14)2/h1-8H,9H2;10-11H,3-9H2,1-2H3 |
| InChIKey | ZLXXDIFITSOLPC-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.82 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67927486 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67927486?
The IUPAC name of CID 67927486 (CID 67927486) is not available.
What is the SMILES notation for CID 67927486?
The canonical SMILES for CID 67927486 is CCCCCCCCn1cncc1C.FC(F)(F)c1cccc(C[B]c2ccccc2Cl)c1.
What is the InChIKey of CID 67927486?
The InChIKey is ZLXXDIFITSOLPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BClF3.C12H22N2/c16-13-7-2-1-6-12(13)15-9-10-4-3-5-11(8-10)14(17,18)19;1-3-4-5-6-7-8-9-14-11-13-10-12(14)2/h1-8H,9H2;10-11H,3-9H2,1-2H3.
What are the key properties of CID 67927486?
CID 67927486 has a molecular weight of 475.82 g/mol, XLogP of 7.44, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67927486 is sourced from PubChem (CID 67927486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).