About 1-tert-butylimidazole;ethyl(diphenyl)borane
1-tert-butylimidazole;ethyl(diphenyl)borane (PubChem CID 67927666) has the molecular formula C21H27BN2
and a molecular weight of 318.27 g/mol. Its IUPAC name is 1-tert-butylimidazole;ethyl(diphenyl)borane.
Molecular Properties
| Compound Name | 1-tert-butylimidazole;ethyl(diphenyl)borane |
| PubChem CID | 67927666 |
| Molecular Formula | C21H27BN2 |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 1-tert-butylimidazole;ethyl(diphenyl)borane |
| SMILES | CC(C)(C)n1ccnc1.CCB(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H15B.C7H12N2/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-7(2,3)9-5-4-8-6-9/h3-12H,2H2,1H3;4-6H,1-3H3 |
| InChIKey | CARHDBYBYGMIBT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butylimidazole;ethyl(diphenyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylimidazole;ethyl(diphenyl)borane?
The IUPAC name of 1-tert-butylimidazole;ethyl(diphenyl)borane (CID 67927666) is 1-tert-butylimidazole;ethyl(diphenyl)borane.
What is the SMILES notation for 1-tert-butylimidazole;ethyl(diphenyl)borane?
The canonical SMILES for 1-tert-butylimidazole;ethyl(diphenyl)borane is CC(C)(C)n1ccnc1.CCB(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-tert-butylimidazole;ethyl(diphenyl)borane?
The InChIKey is CARHDBYBYGMIBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15B.C7H12N2/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-7(2,3)9-5-4-8-6-9/h3-12H,2H2,1H3;4-6H,1-3H3.
What are the key properties of 1-tert-butylimidazole;ethyl(diphenyl)borane?
1-tert-butylimidazole;ethyl(diphenyl)borane has a molecular weight of 318.27 g/mol, XLogP of 3.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylimidazole;ethyl(diphenyl)borane is sourced from PubChem (CID 67927666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).