About acetic acid;3-amino-N-[5-[[2-(2,4-dihydroxyphenyl)acetyl]amino]pentyl]propanamide
acetic acid;3-amino-N-[5-[[2-(2,4-dihydroxyphenyl)acetyl]amino]pentyl]propanamide (PubChem CID 67928038) has the molecular formula C18H29N3O6
and a molecular weight of 383.45 g/mol. Its IUPAC name is acetic acid;3-amino-N-[5-[[2-(2,4-dihydroxyphenyl)acetyl]amino]pentyl]propanamide.
Molecular Properties
| Compound Name | acetic acid;3-amino-N-[5-[[2-(2,4-dihydroxyphenyl)acetyl]amino]pentyl]propanamide |
| PubChem CID | 67928038 |
| Molecular Formula | C18H29N3O6 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | acetic acid;3-amino-N-[5-[[2-(2,4-dihydroxyphenyl)acetyl]amino]pentyl]propanamide |
| SMILES | CC(=O)O.NCCC(=O)NCCCCCNC(=O)Cc1ccc(O)cc1O |
| InChI | InChI=1S/C16H25N3O4.C2H4O2/c17-7-6-15(22)18-8-2-1-3-9-19-16(23)10-12-4-5-13(20)11-14(12)21;1-2(3)4/h4-5,11,20-21H,1-3,6-10,17H2,(H,18,22)(H,19,23);1H3,(H,3,4) |
| InChIKey | RFOWMRLLMSJQJP-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;3-amino-N-[5-[[2-(2,4-dihydroxyphenyl)acetyl]amino]pentyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;3-amino-N-[5-[[2-(2,4-dihydroxyphenyl)acetyl]amino]pentyl]propanamide?
The IUPAC name of acetic acid;3-amino-N-[5-[[2-(2,4-dihydroxyphenyl)acetyl]amino]pentyl]propanamide (CID 67928038) is acetic acid;3-amino-N-[5-[[2-(2,4-dihydroxyphenyl)acetyl]amino]pentyl]propanamide.
What is the SMILES notation for acetic acid;3-amino-N-[5-[[2-(2,4-dihydroxyphenyl)acetyl]amino]pentyl]propanamide?
The canonical SMILES for acetic acid;3-amino-N-[5-[[2-(2,4-dihydroxyphenyl)acetyl]amino]pentyl]propanamide is CC(=O)O.NCCC(=O)NCCCCCNC(=O)Cc1ccc(O)cc1O.
What is the InChIKey of acetic acid;3-amino-N-[5-[[2-(2,4-dihydroxyphenyl)acetyl]amino]pentyl]propanamide?
The InChIKey is RFOWMRLLMSJQJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O4.C2H4O2/c17-7-6-15(22)18-8-2-1-3-9-19-16(23)10-12-4-5-13(20)11-14(12)21;1-2(3)4/h4-5,11,20-21H,1-3,6-10,17H2,(H,18,22)(H,19,23);1H3,(H,3,4).
What are the key properties of acetic acid;3-amino-N-[5-[[2-(2,4-dihydroxyphenyl)acetyl]amino]pentyl]propanamide?
acetic acid;3-amino-N-[5-[[2-(2,4-dihydroxyphenyl)acetyl]amino]pentyl]propanamide has a molecular weight of 383.45 g/mol, XLogP of 0.48, 10 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-amino-N-[5-[[2-(2,4-dihydroxyphenyl)acetyl]amino]pentyl]propanamide is sourced from PubChem (CID 67928038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).