C24H41NO7 — CID 67928126
(Z)-but-2-enedioic acid;trans-1-(diethylamino)propan-2-yl (1R,2R)-2-cyclohexyl-2-hydroxycyclohexane-1-carboxylate (PubChem CID 67928126) has the molecular formula C24H41NO7 and a molecular weight of 455.59 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;trans-1-(diethylamino)propan-2-yl (1R,2R)-2-cyclohexyl-2-hydroxycyclohexane-1-carboxylate.
| Compound Name | (Z)-but-2-enedioic acid;trans-1-(diethylamino)propan-2-yl (1R,2R)-2-cyclohexyl-2-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67928126 |
| Molecular Formula | C24H41NO7 |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | (Z)-but-2-enedioic acid;trans-1-(diethylamino)propan-2-yl (1R,2R)-2-cyclohexyl-2-hydroxycyclohexane-1-carboxylate |
| SMILES | CCN(CC)CC(C)OC(=O)[C@@H]1CCCC[C@@]1(O)C1CCCCC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H37NO3.C4H4O4/c1-4-21(5-2)15-16(3)24-19(22)18-13-9-10-14-20(18,23)17-11-7-6-8-12-17;5-3(6)1-2-4(7)8/h16-18,23H,4-15H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t16?,18-,20+;/m0./s1 |
| InChIKey | YAPLMPMXORABRR-QDURRQDQSA-N |
| XLogP | 3.47 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|