C24H36N3O6P — CID 67928931
(1,3-dioxo-4H-isoquinolin-2-yl)methyl-[4-methyl-2-[[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoyl]pentyl]phosphinic acid (PubChem CID 67928931) has the molecular formula C24H36N3O6P and a molecular weight of 493.54 g/mol. Its IUPAC name is (1,3-dioxo-4H-isoquinolin-2-yl)methyl-[4-methyl-2-[[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoyl]pentyl]phosphinic acid.
| Compound Name | (1,3-dioxo-4H-isoquinolin-2-yl)methyl-[4-methyl-2-[[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoyl]pentyl]phosphinic acid |
|---|---|
| PubChem CID | 67928931 |
| Molecular Formula | C24H36N3O6P |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | (1,3-dioxo-4H-isoquinolin-2-yl)methyl-[4-methyl-2-[[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoyl]pentyl]phosphinic acid |
| SMILES | CNC(=O)[C@H](CC(C)C)NC(=O)C(CC(C)C)CP(=O)(O)CN1C(=O)Cc2ccccc2C1=O |
| InChI | InChI=1S/C24H36N3O6P/c1-15(2)10-18(22(29)26-20(11-16(3)4)23(30)25-5)13-34(32,33)14-27-21(28)12-17-8-6-7-9-19(17)24(27)31/h6-9,15-16,18,20H,10-14H2,1-5H3,(H,25,30)(H,26,29)(H,32,33)/t18?,20-/m0/s1 |
| InChIKey | FFGYGXIIBRSLBH-IJHRGXPZSA-N |
| XLogP | 2.38 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|