C31H54O4 — CID 67929487
(1'R,2'S,3'S,6'R)-2'-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6',8'-dihexylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol (PubChem CID 67929487) has the molecular formula C31H54O4 and a molecular weight of 490.77 g/mol. Its IUPAC name is (1'R,2'S,3'S,6'R)-2'-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6',8'-dihexylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol.
| Compound Name | (1'R,2'S,3'S,6'R)-2'-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6',8'-dihexylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
|---|---|
| PubChem CID | 67929487 |
| Molecular Formula | C31H54O4 |
| Molecular Weight | 490.77 g/mol |
| Exact Mass | 490.40 |
| IUPAC Name | (1'R,2'S,3'S,6'R)-2'-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6',8'-dihexylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
| SMILES | CCCCCCC1[C@H]2[C@H](/C=C/[C@@H](O)C3CCCCC3)[C@@H](O)CC[C@@]2(CCCCCC)C12OCCO2 |
| InChI | InChI=1S/C31H54O4/c1-3-5-7-12-16-26-29-25(17-18-27(32)24-14-10-9-11-15-24)28(33)19-21-30(29,20-13-8-6-4-2)31(26)34-22-23-35-31/h17-18,24-29,32-33H,3-16,19-23H2,1-2H3/b18-17+/t25-,26?,27-,28+,29-,30-/m1/s1 |
| InChIKey | PFERDWKVFNPESV-NPMUFGNHSA-N |
| XLogP | 7.17 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.77 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|