C23H38O4 — CID 67929490
(1'R,2'S,3'S,6'R)-2'-[(E,3S)-4-cyclohexyl-3-hydroxybut-1-enyl]-8'-ethyl-6'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol (PubChem CID 67929490) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is (1'R,2'S,3'S,6'R)-2'-[(E,3S)-4-cyclohexyl-3-hydroxybut-1-enyl]-8'-ethyl-6'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol.
| Compound Name | (1'R,2'S,3'S,6'R)-2'-[(E,3S)-4-cyclohexyl-3-hydroxybut-1-enyl]-8'-ethyl-6'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
|---|---|
| PubChem CID | 67929490 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | (1'R,2'S,3'S,6'R)-2'-[(E,3S)-4-cyclohexyl-3-hydroxybut-1-enyl]-8'-ethyl-6'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
| SMILES | CCC1[C@H]2[C@H](/C=C/[C@@H](O)CC3CCCCC3)[C@@H](O)CC[C@@]2(C)C12OCCO2 |
| InChI | InChI=1S/C23H38O4/c1-3-19-21-18(10-9-17(24)15-16-7-5-4-6-8-16)20(25)11-12-22(21,2)23(19)26-13-14-27-23/h9-10,16-21,24-25H,3-8,11-15H2,1-2H3/b10-9+/t17-,18-,19?,20+,21-,22-/m1/s1 |
| InChIKey | OAAGVZXCUHEUTJ-XIKNCARYSA-N |
| XLogP | 4.05 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|