C13H24N2O6 — CID 67929862
2-amino-N-[[(1S,2R)-2-hydroxycyclohexyl]methyl]-2-methylpropanamide;oxalic acid (PubChem CID 67929862) has the molecular formula C13H24N2O6 and a molecular weight of 304.34 g/mol. Its IUPAC name is 2-amino-N-[[(1S,2R)-2-hydroxycyclohexyl]methyl]-2-methylpropanamide;oxalic acid.
| Compound Name | 2-amino-N-[[(1S,2R)-2-hydroxycyclohexyl]methyl]-2-methylpropanamide;oxalic acid |
|---|---|
| PubChem CID | 67929862 |
| Molecular Formula | C13H24N2O6 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-amino-N-[[(1S,2R)-2-hydroxycyclohexyl]methyl]-2-methylpropanamide;oxalic acid |
| SMILES | CC(C)(N)C(=O)NC[C@@H]1CCCC[C@H]1O.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H22N2O2.C2H2O4/c1-11(2,12)10(15)13-7-8-5-3-4-6-9(8)14;3-1(4)2(5)6/h8-9,14H,3-7,12H2,1-2H3,(H,13,15);(H,3,4)(H,5,6)/t8-,9+;/m0./s1 |
| InChIKey | XHMXHYKMAUNZJK-OULXEKPRSA-N |
| XLogP | -0.45 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|