C14H22N2O8 — CID 67929869
4-hydroxy-4-(piperazine-1-carbonyl)cyclohexane-1-carboxylic acid;oxalic acid (PubChem CID 67929869) has the molecular formula C14H22N2O8 and a molecular weight of 346.34 g/mol. Its IUPAC name is 4-hydroxy-4-(piperazine-1-carbonyl)cyclohexane-1-carboxylic acid;oxalic acid.
| Compound Name | 4-hydroxy-4-(piperazine-1-carbonyl)cyclohexane-1-carboxylic acid;oxalic acid |
|---|---|
| PubChem CID | 67929869 |
| Molecular Formula | C14H22N2O8 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 4-hydroxy-4-(piperazine-1-carbonyl)cyclohexane-1-carboxylic acid;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(O)C1CCC(O)(C(=O)N2CCNCC2)CC1 |
| InChI | InChI=1S/C12H20N2O4.C2H2O4/c15-10(16)9-1-3-12(18,4-2-9)11(17)14-7-5-13-6-8-14;3-1(4)2(5)6/h9,13,18H,1-8H2,(H,15,16);(H,3,4)(H,5,6) |
| InChIKey | VBTIPZWRQULBSC-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|