C13H14O4 — CID 67930744
(1R,2S,5R)-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 67930744) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is (1R,2S,5R)-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1R,2S,5R)-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 67930744 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (1R,2S,5R)-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | O=C1C[C@H](OCc2ccccc2)[C@H]2CO[C@@H]1O2 |
| InChI | InChI=1S/C13H14O4/c14-10-6-11(12-8-16-13(10)17-12)15-7-9-4-2-1-3-5-9/h1-5,11-13H,6-8H2/t11-,12+,13+/m0/s1 |
| InChIKey | XNDGBJPFZHTNKG-YNEHKIRRSA-N |
| XLogP | 1.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |