C30H20N2O8 — CID 67930889
bis[4-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]phenyl] benzene-1,4-dicarboxylate (PubChem CID 67930889) has the molecular formula C30H20N2O8 and a molecular weight of 536.50 g/mol. Its IUPAC name is bis[4-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]phenyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[4-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]phenyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 67930889 |
| Molecular Formula | C30H20N2O8 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | bis[4-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]phenyl] benzene-1,4-dicarboxylate |
| SMILES | COC(=O)/C(C#N)=C/c1ccc(OC(=O)c2ccc(C(=O)Oc3ccc(/C=C(\C#N)C(=O)OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H20N2O8/c1-37-27(33)23(17-31)15-19-3-11-25(12-4-19)39-29(35)21-7-9-22(10-8-21)30(36)40-26-13-5-20(6-14-26)16-24(18-32)28(34)38-2/h3-16H,1-2H3/b23-15+,24-16+ |
| InChIKey | RLMNTMPLCIUJNW-DFEHQXHXSA-N |
| XLogP | 4.28 |
| TPSA | 152.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|