C20H36Br2O2Si2 — CID 67931117
tert-butyl-[3,3-dibromo-2-[tert-butyl(dimethyl)silyl]oxy-4-ethenylcyclohexa-1,5-dien-1-yl]oxy-dimethylsilane (PubChem CID 67931117) has the molecular formula C20H36Br2O2Si2 and a molecular weight of 524.49 g/mol. Its IUPAC name is tert-butyl-[3,3-dibromo-2-[tert-butyl(dimethyl)silyl]oxy-4-ethenylcyclohexa-1,5-dien-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[3,3-dibromo-2-[tert-butyl(dimethyl)silyl]oxy-4-ethenylcyclohexa-1,5-dien-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 67931117 |
| Molecular Formula | C20H36Br2O2Si2 |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | tert-butyl-[3,3-dibromo-2-[tert-butyl(dimethyl)silyl]oxy-4-ethenylcyclohexa-1,5-dien-1-yl]oxy-dimethylsilane |
| SMILES | C=CC1C=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C1(Br)Br |
| InChI | InChI=1S/C20H36Br2O2Si2/c1-12-15-13-14-16(23-25(8,9)18(2,3)4)17(20(15,21)22)24-26(10,11)19(5,6)7/h12-15H,1H2,2-11H3 |
| InChIKey | AFQNJSUMPUFADW-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|