About sodium;2-hydroxybenzoate;1-methylpyrrolidin-2-one
sodium;2-hydroxybenzoate;1-methylpyrrolidin-2-one (PubChem CID 67931459) has the molecular formula C12H14NNaO4
and a molecular weight of 259.24 g/mol. Its IUPAC name is sodium;2-hydroxybenzoate;1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | sodium;2-hydroxybenzoate;1-methylpyrrolidin-2-one |
| PubChem CID | 67931459 |
| Molecular Formula | C12H14NNaO4 |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | sodium;2-hydroxybenzoate;1-methylpyrrolidin-2-one |
| SMILES | CN1CCCC1=O.O=C([O-])c1ccccc1O.[Na+] |
| InChI | InChI=1S/C7H6O3.C5H9NO.Na/c8-6-4-2-1-3-5(6)7(9)10;1-6-4-2-3-5(6)7;/h1-4,8H,(H,9,10);2-4H2,1H3;/q;;+1/p-1 |
| InChIKey | POZGVALFALCAJO-UHFFFAOYSA-M |
| XLogP | -3.00 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium;2-hydroxybenzoate;1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-hydroxybenzoate;1-methylpyrrolidin-2-one?
The IUPAC name of sodium;2-hydroxybenzoate;1-methylpyrrolidin-2-one (CID 67931459) is sodium;2-hydroxybenzoate;1-methylpyrrolidin-2-one.
What is the SMILES notation for sodium;2-hydroxybenzoate;1-methylpyrrolidin-2-one?
The canonical SMILES for sodium;2-hydroxybenzoate;1-methylpyrrolidin-2-one is CN1CCCC1=O.O=C([O-])c1ccccc1O.[Na+].
What is the InChIKey of sodium;2-hydroxybenzoate;1-methylpyrrolidin-2-one?
The InChIKey is POZGVALFALCAJO-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O3.C5H9NO.Na/c8-6-4-2-1-3-5(6)7(9)10;1-6-4-2-3-5(6)7;/h1-4,8H,(H,9,10);2-4H2,1H3;/q;;+1/p-1.
What are the key properties of sodium;2-hydroxybenzoate;1-methylpyrrolidin-2-one?
sodium;2-hydroxybenzoate;1-methylpyrrolidin-2-one has a molecular weight of 259.24 g/mol, XLogP of -3.00, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-hydroxybenzoate;1-methylpyrrolidin-2-one is sourced from PubChem (CID 67931459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).