About oxolane-2,3-diimine
oxolane-2,3-diimine (PubChem CID 67931576) has the molecular formula C4H6N2O
and a molecular weight of 98.10 g/mol. Its IUPAC name is oxolane-2,3-diimine.
Molecular Properties
| Compound Name | oxolane-2,3-diimine |
| PubChem CID | 67931576 |
| Molecular Formula | C4H6N2O |
| Molecular Weight | 98.10 g/mol |
| Exact Mass | 98.05 |
| IUPAC Name | oxolane-2,3-diimine |
| SMILES | [H]/N=C1\OCC\C1=N/[H] |
| InChI | InChI=1S/C4H6N2O/c5-3-1-2-7-4(3)6/h5-6H,1-2H2/b5-3+,6-4- |
| InChIKey | JGNOFTVMMVOYFT-UZNMPDEFSA-N |
| XLogP | 0.40 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.10 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze oxolane-2,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolane-2,3-diimine?
The IUPAC name of oxolane-2,3-diimine (CID 67931576) is oxolane-2,3-diimine.
What is the SMILES notation for oxolane-2,3-diimine?
The canonical SMILES for oxolane-2,3-diimine is [H]/N=C1\OCC\C1=N/[H].
What is the InChIKey of oxolane-2,3-diimine?
The InChIKey is JGNOFTVMMVOYFT-UZNMPDEFSA-N. The full InChI is InChI=1S/C4H6N2O/c5-3-1-2-7-4(3)6/h5-6H,1-2H2/b5-3+,6-4-.
What are the key properties of oxolane-2,3-diimine?
oxolane-2,3-diimine has a molecular weight of 98.10 g/mol, XLogP of 0.40, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxolane-2,3-diimine is sourced from PubChem (CID 67931576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).