About bicyclo[3.1.0]hexa-1(6),2,4-triene;1,3-oxazolidin-5-ylmethanol
bicyclo[3.1.0]hexa-1(6),2,4-triene;1,3-oxazolidin-5-ylmethanol (PubChem CID 67931751) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;1,3-oxazolidin-5-ylmethanol.
Molecular Properties
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;1,3-oxazolidin-5-ylmethanol |
| PubChem CID | 67931751 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;1,3-oxazolidin-5-ylmethanol |
| SMILES | OCC1CNCO1.c1cc2cc-2c1 |
| InChI | InChI=1S/C6H4.C4H9NO2/c1-2-5-4-6(5)3-1;6-2-4-1-5-3-7-4/h1-4H;4-6H,1-3H2 |
| InChIKey | HFFBYLYELVWNJU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bicyclo[3.1.0]hexa-1(6),2,4-triene;1,3-oxazolidin-5-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;1,3-oxazolidin-5-ylmethanol?
The IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;1,3-oxazolidin-5-ylmethanol (CID 67931751) is bicyclo[3.1.0]hexa-1(6),2,4-triene;1,3-oxazolidin-5-ylmethanol.
What is the SMILES notation for bicyclo[3.1.0]hexa-1(6),2,4-triene;1,3-oxazolidin-5-ylmethanol?
The canonical SMILES for bicyclo[3.1.0]hexa-1(6),2,4-triene;1,3-oxazolidin-5-ylmethanol is OCC1CNCO1.c1cc2cc-2c1.
What is the InChIKey of bicyclo[3.1.0]hexa-1(6),2,4-triene;1,3-oxazolidin-5-ylmethanol?
The InChIKey is HFFBYLYELVWNJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4.C4H9NO2/c1-2-5-4-6(5)3-1;6-2-4-1-5-3-7-4/h1-4H;4-6H,1-3H2.
What are the key properties of bicyclo[3.1.0]hexa-1(6),2,4-triene;1,3-oxazolidin-5-ylmethanol?
bicyclo[3.1.0]hexa-1(6),2,4-triene;1,3-oxazolidin-5-ylmethanol has a molecular weight of 179.22 g/mol, XLogP of 0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.0]hexa-1(6),2,4-triene;1,3-oxazolidin-5-ylmethanol is sourced from PubChem (CID 67931751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).