C21H38O6Si — CID 67931872
[(1'R,2'R,3'aS,6'aR)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl] methyl carbonate (PubChem CID 67931872) has the molecular formula C21H38O6Si and a molecular weight of 414.62 g/mol. Its IUPAC name is [(1'R,2'R,3'aS,6'aR)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl] methyl carbonate.
| Compound Name | [(1'R,2'R,3'aS,6'aR)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl] methyl carbonate |
|---|---|
| PubChem CID | 67931872 |
| Molecular Formula | C21H38O6Si |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | [(1'R,2'R,3'aS,6'aR)-2'-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl] methyl carbonate |
| SMILES | COC(=O)O[C@@H]1[C@@H]2CC3(C[C@@H]2C[C@H]1O[Si](C)(C)C(C)(C)C)OCC(C)(C)CO3 |
| InChI | InChI=1S/C21H38O6Si/c1-19(2,3)28(7,8)27-16-9-14-10-21(24-12-20(4,5)13-25-21)11-15(14)17(16)26-18(22)23-6/h14-17H,9-13H2,1-8H3/t14-,15+,16+,17+/m0/s1 |
| InChIKey | NNATZJWUAFHPFQ-YLFCFFPRSA-N |
| XLogP | 4.73 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|