C42H46N2O12 — CID 67931956
bis[7,8-dimethoxy-5-(4-methoxyphenoxy)-1,2,3,4-tetrahydro-3-benzazepin-5-yl] (Z)-but-2-enedioate (PubChem CID 67931956) has the molecular formula C42H46N2O12 and a molecular weight of 770.83 g/mol. Its IUPAC name is bis[7,8-dimethoxy-5-(4-methoxyphenoxy)-1,2,3,4-tetrahydro-3-benzazepin-5-yl] (Z)-but-2-enedioate.
| Compound Name | bis[7,8-dimethoxy-5-(4-methoxyphenoxy)-1,2,3,4-tetrahydro-3-benzazepin-5-yl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 67931956 |
| Molecular Formula | C42H46N2O12 |
| Molecular Weight | 770.83 g/mol |
| Exact Mass | 770.31 |
| IUPAC Name | bis[7,8-dimethoxy-5-(4-methoxyphenoxy)-1,2,3,4-tetrahydro-3-benzazepin-5-yl] (Z)-but-2-enedioate |
| SMILES | COc1ccc(OC2(OC(=O)/C=C\C(=O)OC3(Oc4ccc(OC)cc4)CNCCc4cc(OC)c(OC)cc43)CNCCc3cc(OC)c(OC)cc32)cc1 |
| InChI | InChI=1S/C42H46N2O12/c1-47-29-7-11-31(12-8-29)53-41(25-43-19-17-27-21-35(49-3)37(51-5)23-33(27)41)55-39(45)15-16-40(46)56-42(54-32-13-9-30(48-2)10-14-32)26-44-20-18-28-22-36(50-4)38(52-6)24-34(28)42/h7-16,21-24,43-44H,17-20,25-26H2,1-6H3/b16-15- |
| InChIKey | JGQSZBHDPLKWHG-NXVVXOECSA-N |
| XLogP | 4.84 |
| TPSA | 150.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.83 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|