C37H32O6 — CID 67932172
3-methyl-6-phenylbenzene-1,2-diol;bis(3-phenylbenzene-1,2-diol) (PubChem CID 67932172) has the molecular formula C37H32O6 and a molecular weight of 572.66 g/mol. Its IUPAC name is 3-methyl-6-phenylbenzene-1,2-diol;bis(3-phenylbenzene-1,2-diol).
| Compound Name | 3-methyl-6-phenylbenzene-1,2-diol;bis(3-phenylbenzene-1,2-diol) |
|---|---|
| PubChem CID | 67932172 |
| Molecular Formula | C37H32O6 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | 3-methyl-6-phenylbenzene-1,2-diol;bis(3-phenylbenzene-1,2-diol) |
| SMILES | Cc1ccc(-c2ccccc2)c(O)c1O.Oc1cccc(-c2ccccc2)c1O.Oc1cccc(-c2ccccc2)c1O |
| InChI | InChI=1S/C13H12O2.2C12H10O2/c1-9-7-8-11(13(15)12(9)14)10-5-3-2-4-6-10;2*13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9/h2-8,14-15H,1H3;2*1-8,13-14H |
| InChIKey | ZLDIXZZKPICBFB-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|