C25H38O7 — CID 67932228
(2S,4S,4aS,5S,6S,8aR)-4-(2,2-dimethylbutanoyloxy)-5-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-6-methyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene-2-carboxylic acid (PubChem CID 67932228) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is (2S,4S,4aS,5S,6S,8aR)-4-(2,2-dimethylbutanoyloxy)-5-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-6-methyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene-2-carboxylic acid.
| Compound Name | (2S,4S,4aS,5S,6S,8aR)-4-(2,2-dimethylbutanoyloxy)-5-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-6-methyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 67932228 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | (2S,4S,4aS,5S,6S,8aR)-4-(2,2-dimethylbutanoyloxy)-5-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-6-methyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene-2-carboxylic acid |
| SMILES | CCC(C)(C)C(=O)O[C@H]1C[C@@H](C(=O)O)C[C@@H]2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@@H]12 |
| InChI | InChI=1S/C25H38O7/c1-5-25(3,4)24(30)32-20-11-16(23(28)29)10-15-7-6-14(2)19(22(15)20)9-8-18-12-17(26)13-21(27)31-18/h6-7,14-20,22,26H,5,8-13H2,1-4H3,(H,28,29)/t14-,15-,16-,17+,18+,19-,20-,22-/m0/s1 |
| InChIKey | ZQBXORBIEBLSGZ-UHVQSNBXSA-N |
| XLogP | 3.73 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|