C25H34O8 — CID 67932229
(2S,4S,4aR,5S,6S)-4-(2,2-dimethylbutanoyloxy)-5-[2-[(2R,4R)-4-hydroxy-5,6-dioxooxan-2-yl]ethyl]-6-methyl-2,3,4,4a,5,6-hexahydronaphthalene-2-carboxylic acid (PubChem CID 67932229) has the molecular formula C25H34O8 and a molecular weight of 462.54 g/mol. Its IUPAC name is (2S,4S,4aR,5S,6S)-4-(2,2-dimethylbutanoyloxy)-5-[2-[(2R,4R)-4-hydroxy-5,6-dioxooxan-2-yl]ethyl]-6-methyl-2,3,4,4a,5,6-hexahydronaphthalene-2-carboxylic acid.
| Compound Name | (2S,4S,4aR,5S,6S)-4-(2,2-dimethylbutanoyloxy)-5-[2-[(2R,4R)-4-hydroxy-5,6-dioxooxan-2-yl]ethyl]-6-methyl-2,3,4,4a,5,6-hexahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 67932229 |
| Molecular Formula | C25H34O8 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | (2S,4S,4aR,5S,6S)-4-(2,2-dimethylbutanoyloxy)-5-[2-[(2R,4R)-4-hydroxy-5,6-dioxooxan-2-yl]ethyl]-6-methyl-2,3,4,4a,5,6-hexahydronaphthalene-2-carboxylic acid |
| SMILES | CCC(C)(C)C(=O)O[C@H]1C[C@H](C(=O)O)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)C(=O)C(=O)O3)[C@H]21 |
| InChI | InChI=1S/C25H34O8/c1-5-25(3,4)24(31)33-19-11-15(22(28)29)10-14-7-6-13(2)17(20(14)19)9-8-16-12-18(26)21(27)23(30)32-16/h6-7,10,13,15-20,26H,5,8-9,11-12H2,1-4H3,(H,28,29)/t13-,15+,16+,17-,18+,19-,20-/m0/s1 |
| InChIKey | NJVPVQSOEHCQDY-FJEFBTNGSA-N |
| XLogP | 2.83 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|