About 1-(5-propan-2-ylidenecyclopenta-1,3-dien-1-yl)ethanone
1-(5-propan-2-ylidenecyclopenta-1,3-dien-1-yl)ethanone (PubChem CID 67932454) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is 1-(5-propan-2-ylidenecyclopenta-1,3-dien-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(5-propan-2-ylidenecyclopenta-1,3-dien-1-yl)ethanone |
| PubChem CID | 67932454 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 1-(5-propan-2-ylidenecyclopenta-1,3-dien-1-yl)ethanone |
| SMILES | CC(=O)C1=CC=CC1=C(C)C |
| InChI | InChI=1S/C10H12O/c1-7(2)9-5-4-6-10(9)8(3)11/h4-6H,1-3H3 |
| InChIKey | BCRAQNGZMMFVDN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(5-propan-2-ylidenecyclopenta-1,3-dien-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-propan-2-ylidenecyclopenta-1,3-dien-1-yl)ethanone?
The IUPAC name of 1-(5-propan-2-ylidenecyclopenta-1,3-dien-1-yl)ethanone (CID 67932454) is 1-(5-propan-2-ylidenecyclopenta-1,3-dien-1-yl)ethanone.
What is the SMILES notation for 1-(5-propan-2-ylidenecyclopenta-1,3-dien-1-yl)ethanone?
The canonical SMILES for 1-(5-propan-2-ylidenecyclopenta-1,3-dien-1-yl)ethanone is CC(=O)C1=CC=CC1=C(C)C.
What is the InChIKey of 1-(5-propan-2-ylidenecyclopenta-1,3-dien-1-yl)ethanone?
The InChIKey is BCRAQNGZMMFVDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O/c1-7(2)9-5-4-6-10(9)8(3)11/h4-6H,1-3H3.
What are the key properties of 1-(5-propan-2-ylidenecyclopenta-1,3-dien-1-yl)ethanone?
1-(5-propan-2-ylidenecyclopenta-1,3-dien-1-yl)ethanone has a molecular weight of 148.20 g/mol, XLogP of 2.41, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-propan-2-ylidenecyclopenta-1,3-dien-1-yl)ethanone is sourced from PubChem (CID 67932454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).