About 4-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-2,4-dien-1-imine
4-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-2,4-dien-1-imine (PubChem CID 67932532) has the molecular formula C14H14N2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | 4-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-2,4-dien-1-imine |
| PubChem CID | 67932532 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 4-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC(C=CC2=CC/C(=N\[H])C=C2)=CC1 |
| InChI | InChI=1S/C14H14N2/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12/h1-7,9,15-16H,8,10H2/b2-1?,15-13-,16-14+ |
| InChIKey | ZJGFDMRVEHKCEN-OUNLNTPUSA-N |
| XLogP | 3.35 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-2,4-dien-1-imine?
The IUPAC name of 4-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-2,4-dien-1-imine (CID 67932532) is 4-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-2,4-dien-1-imine.
What is the SMILES notation for 4-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-2,4-dien-1-imine?
The canonical SMILES for 4-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-2,4-dien-1-imine is [H]/N=C1\C=CC(C=CC2=CC/C(=N\[H])C=C2)=CC1.
What is the InChIKey of 4-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-2,4-dien-1-imine?
The InChIKey is ZJGFDMRVEHKCEN-OUNLNTPUSA-N. The full InChI is InChI=1S/C14H14N2/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12/h1-7,9,15-16H,8,10H2/b2-1?,15-13-,16-14+.
What are the key properties of 4-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-2,4-dien-1-imine?
4-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-2,4-dien-1-imine has a molecular weight of 210.28 g/mol, XLogP of 3.35, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-iminocyclohexa-1,5-dien-1-yl)ethenyl]cyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 67932532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).