C24H48N4 — CID 67932845
1-N-cyclohexyl-1-N'-[1-(cyclohexylamino)ethyl]-1-N'-[2-(cyclohexylamino)ethyl]ethane-1,1-diamine (PubChem CID 67932845) has the molecular formula C24H48N4 and a molecular weight of 392.68 g/mol. Its IUPAC name is 1-N-cyclohexyl-1-N'-[1-(cyclohexylamino)ethyl]-1-N'-[2-(cyclohexylamino)ethyl]ethane-1,1-diamine.
| Compound Name | 1-N-cyclohexyl-1-N'-[1-(cyclohexylamino)ethyl]-1-N'-[2-(cyclohexylamino)ethyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 67932845 |
| Molecular Formula | C24H48N4 |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 392.39 |
| IUPAC Name | 1-N-cyclohexyl-1-N'-[1-(cyclohexylamino)ethyl]-1-N'-[2-(cyclohexylamino)ethyl]ethane-1,1-diamine |
| SMILES | CC(NC1CCCCC1)N(CCNC1CCCCC1)C(C)NC1CCCCC1 |
| InChI | InChI=1S/C24H48N4/c1-20(26-23-14-8-4-9-15-23)28(19-18-25-22-12-6-3-7-13-22)21(2)27-24-16-10-5-11-17-24/h20-27H,3-19H2,1-2H3 |
| InChIKey | NVJDVNPKBSBQKU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|