C16H17NS — CID 67932852
6-(4-methylphenyl)sulfanyl-6,7,8,8a-tetrahydroquinoline (PubChem CID 67932852) has the molecular formula C16H17NS and a molecular weight of 255.39 g/mol. Its IUPAC name is 6-(4-methylphenyl)sulfanyl-6,7,8,8a-tetrahydroquinoline.
| Compound Name | 6-(4-methylphenyl)sulfanyl-6,7,8,8a-tetrahydroquinoline |
|---|---|
| PubChem CID | 67932852 |
| Molecular Formula | C16H17NS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 6-(4-methylphenyl)sulfanyl-6,7,8,8a-tetrahydroquinoline |
| SMILES | Cc1ccc(SC2C=C3C=CC=NC3CC2)cc1 |
| InChI | InChI=1S/C16H17NS/c1-12-4-6-14(7-5-12)18-15-8-9-16-13(11-15)3-2-10-17-16/h2-7,10-11,15-16H,8-9H2,1H3 |
| InChIKey | NXBQRQGOWRVQPY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |