C27H26Cl4N4O3 — CID 67932869
1-[4-chloro-3-[[3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-5-yl]amino]phenyl]-3-oct-1-enylpyrrolidine-2,5-dione (PubChem CID 67932869) has the molecular formula C27H26Cl4N4O3 and a molecular weight of 596.34 g/mol. Its IUPAC name is 1-[4-chloro-3-[[3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-5-yl]amino]phenyl]-3-oct-1-enylpyrrolidine-2,5-dione.
| Compound Name | 1-[4-chloro-3-[[3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-5-yl]amino]phenyl]-3-oct-1-enylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 67932869 |
| Molecular Formula | C27H26Cl4N4O3 |
| Molecular Weight | 596.34 g/mol |
| Exact Mass | 594.08 |
| IUPAC Name | 1-[4-chloro-3-[[3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-5-yl]amino]phenyl]-3-oct-1-enylpyrrolidine-2,5-dione |
| SMILES | CCCCCCC=CC1CC(=O)N(c2ccc(Cl)c(Nc3cc(=O)n(-c4c(Cl)cc(Cl)cc4Cl)[nH]3)c2)C1=O |
| InChI | InChI=1S/C27H26Cl4N4O3/c1-2-3-4-5-6-7-8-16-11-24(36)34(27(16)38)18-9-10-19(29)22(14-18)32-23-15-25(37)35(33-23)26-20(30)12-17(28)13-21(26)31/h7-10,12-16,32-33H,2-6,11H2,1H3 |
| InChIKey | VOBRUJDMOOEMEU-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.34 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|