About N,N-dibutyl-1,2-dihydropyridin-3-amine
N,N-dibutyl-1,2-dihydropyridin-3-amine (PubChem CID 67933411) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is N,N-dibutyl-1,2-dihydropyridin-3-amine.
Molecular Properties
| Compound Name | N,N-dibutyl-1,2-dihydropyridin-3-amine |
| PubChem CID | 67933411 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N,N-dibutyl-1,2-dihydropyridin-3-amine |
| SMILES | CCCCN(CCCC)C1=CC=CNC1 |
| InChI | InChI=1S/C13H24N2/c1-3-5-10-15(11-6-4-2)13-8-7-9-14-12-13/h7-9,14H,3-6,10-12H2,1-2H3 |
| InChIKey | TWKWKXUCFQJJHE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dibutyl-1,2-dihydropyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutyl-1,2-dihydropyridin-3-amine?
The IUPAC name of N,N-dibutyl-1,2-dihydropyridin-3-amine (CID 67933411) is N,N-dibutyl-1,2-dihydropyridin-3-amine.
What is the SMILES notation for N,N-dibutyl-1,2-dihydropyridin-3-amine?
The canonical SMILES for N,N-dibutyl-1,2-dihydropyridin-3-amine is CCCCN(CCCC)C1=CC=CNC1.
What is the InChIKey of N,N-dibutyl-1,2-dihydropyridin-3-amine?
The InChIKey is TWKWKXUCFQJJHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2/c1-3-5-10-15(11-6-4-2)13-8-7-9-14-12-13/h7-9,14H,3-6,10-12H2,1-2H3.
What are the key properties of N,N-dibutyl-1,2-dihydropyridin-3-amine?
N,N-dibutyl-1,2-dihydropyridin-3-amine has a molecular weight of 208.35 g/mol, XLogP of 2.89, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutyl-1,2-dihydropyridin-3-amine is sourced from PubChem (CID 67933411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).