About tert-butyl 4-amino-2,2-bis[1-(butylcarbamoyloxy)ethyl]piperidine-1-carboxylate
tert-butyl 4-amino-2,2-bis[1-(butylcarbamoyloxy)ethyl]piperidine-1-carboxylate (PubChem CID 67933455) has the molecular formula C24H46N4O6
and a molecular weight of 486.65 g/mol. Its IUPAC name is tert-butyl 4-amino-2,2-bis[1-(butylcarbamoyloxy)ethyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-amino-2,2-bis[1-(butylcarbamoyloxy)ethyl]piperidine-1-carboxylate |
| PubChem CID | 67933455 |
| Molecular Formula | C24H46N4O6 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | tert-butyl 4-amino-2,2-bis[1-(butylcarbamoyloxy)ethyl]piperidine-1-carboxylate |
| SMILES | CCCCNC(=O)OC(C)C1(C(C)OC(=O)NCCCC)CC(N)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H46N4O6/c1-8-10-13-26-20(29)32-17(3)24(18(4)33-21(30)27-14-11-9-2)16-19(25)12-15-28(24)22(31)34-23(5,6)7/h17-19H,8-16,25H2,1-7H3,(H,26,29)(H,27,30) |
| InChIKey | PRBHHARAEFXEEV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-amino-2,2-bis[1-(butylcarbamoyloxy)ethyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-amino-2,2-bis[1-(butylcarbamoyloxy)ethyl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-amino-2,2-bis[1-(butylcarbamoyloxy)ethyl]piperidine-1-carboxylate (CID 67933455) is tert-butyl 4-amino-2,2-bis[1-(butylcarbamoyloxy)ethyl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-amino-2,2-bis[1-(butylcarbamoyloxy)ethyl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-amino-2,2-bis[1-(butylcarbamoyloxy)ethyl]piperidine-1-carboxylate is CCCCNC(=O)OC(C)C1(C(C)OC(=O)NCCCC)CC(N)CCN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 4-amino-2,2-bis[1-(butylcarbamoyloxy)ethyl]piperidine-1-carboxylate?
The InChIKey is PRBHHARAEFXEEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46N4O6/c1-8-10-13-26-20(29)32-17(3)24(18(4)33-21(30)27-14-11-9-2)16-19(25)12-15-28(24)22(31)34-23(5,6)7/h17-19H,8-16,25H2,1-7H3,(H,26,29)(H,27,30).
What are the key properties of tert-butyl 4-amino-2,2-bis[1-(butylcarbamoyloxy)ethyl]piperidine-1-carboxylate?
tert-butyl 4-amino-2,2-bis[1-(butylcarbamoyloxy)ethyl]piperidine-1-carboxylate has a molecular weight of 486.65 g/mol, XLogP of 3.91, 10 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-amino-2,2-bis[1-(butylcarbamoyloxy)ethyl]piperidine-1-carboxylate is sourced from PubChem (CID 67933455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).