C16H19N3O5 — CID 67933758
2-oxopropyl N-[(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]carbamate (PubChem CID 67933758) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-oxopropyl N-[(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]carbamate.
| Compound Name | 2-oxopropyl N-[(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]carbamate |
|---|---|
| PubChem CID | 67933758 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-oxopropyl N-[(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]carbamate |
| SMILES | CC(=O)COC(=O)NNC1c2cc(C#N)ccc2OC(C)(C)C1O |
| InChI | InChI=1S/C16H19N3O5/c1-9(20)8-23-15(22)19-18-13-11-6-10(7-17)4-5-12(11)24-16(2,3)14(13)21/h4-6,13-14,18,21H,8H2,1-3H3,(H,19,22) |
| InChIKey | CYMHTVHTQYEAIF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|