C13H18O7 — CID 67933995
5-(2,5-dihydroxyoxolan-3-yl)-3-methylcyclohex-3-ene-1,2-dicarboxylic acid (PubChem CID 67933995) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is 5-(2,5-dihydroxyoxolan-3-yl)-3-methylcyclohex-3-ene-1,2-dicarboxylic acid.
| Compound Name | 5-(2,5-dihydroxyoxolan-3-yl)-3-methylcyclohex-3-ene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 67933995 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 5-(2,5-dihydroxyoxolan-3-yl)-3-methylcyclohex-3-ene-1,2-dicarboxylic acid |
| SMILES | CC1=CC(C2CC(O)OC2O)CC(C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C13H18O7/c1-5-2-6(7-4-9(14)20-13(7)19)3-8(11(15)16)10(5)12(17)18/h2,6-10,13-14,19H,3-4H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | VYRXUOIMXHXEQB-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|