C19H25NO4 — CID 67934205
1-[(1,3-dioxo-3a,4,5,7a-tetrahydroisoindol-2-yl)methyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylic acid (PubChem CID 67934205) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 1-[(1,3-dioxo-3a,4,5,7a-tetrahydroisoindol-2-yl)methyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(1,3-dioxo-3a,4,5,7a-tetrahydroisoindol-2-yl)methyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 67934205 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 1-[(1,3-dioxo-3a,4,5,7a-tetrahydroisoindol-2-yl)methyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylic acid |
| SMILES | CC(C)=CC1C(C)(C)C1(CN1C(=O)C2C=CCCC2C1=O)C(=O)O |
| InChI | InChI=1S/C19H25NO4/c1-11(2)9-14-18(3,4)19(14,17(23)24)10-20-15(21)12-7-5-6-8-13(12)16(20)22/h5,7,9,12-14H,6,8,10H2,1-4H3,(H,23,24) |
| InChIKey | MRZDDUCWTWGPQJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|