About 4-phenyl-4H-1,2-benzoxazin-3-one
4-phenyl-4H-1,2-benzoxazin-3-one (PubChem CID 67934215) has the molecular formula C14H11NO2
and a molecular weight of 225.25 g/mol. Its IUPAC name is 4-phenyl-4H-1,2-benzoxazin-3-one.
Molecular Properties
| Compound Name | 4-phenyl-4H-1,2-benzoxazin-3-one |
| PubChem CID | 67934215 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 4-phenyl-4H-1,2-benzoxazin-3-one |
| SMILES | O=C1NOc2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C14H11NO2/c16-14-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)17-15-14/h1-9,13H,(H,15,16) |
| InChIKey | QQQWLVDAETUFHS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenyl-4H-1,2-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-4H-1,2-benzoxazin-3-one?
The IUPAC name of 4-phenyl-4H-1,2-benzoxazin-3-one (CID 67934215) is 4-phenyl-4H-1,2-benzoxazin-3-one.
What is the SMILES notation for 4-phenyl-4H-1,2-benzoxazin-3-one?
The canonical SMILES for 4-phenyl-4H-1,2-benzoxazin-3-one is O=C1NOc2ccccc2C1c1ccccc1.
What is the InChIKey of 4-phenyl-4H-1,2-benzoxazin-3-one?
The InChIKey is QQQWLVDAETUFHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2/c16-14-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)17-15-14/h1-9,13H,(H,15,16).
What are the key properties of 4-phenyl-4H-1,2-benzoxazin-3-one?
4-phenyl-4H-1,2-benzoxazin-3-one has a molecular weight of 225.25 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-4H-1,2-benzoxazin-3-one is sourced from PubChem (CID 67934215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).