About 1-(cyclohexa-1,5-dien-1-ylmethyl)pyrazol-3-amine
1-(cyclohexa-1,5-dien-1-ylmethyl)pyrazol-3-amine (PubChem CID 67934717) has the molecular formula C10H13N3
and a molecular weight of 175.24 g/mol. Its IUPAC name is 1-(cyclohexa-1,5-dien-1-ylmethyl)pyrazol-3-amine.
Molecular Properties
| Compound Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)pyrazol-3-amine |
| PubChem CID | 67934717 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)pyrazol-3-amine |
| SMILES | Nc1ccn(CC2=CCCC=C2)n1 |
| InChI | InChI=1S/C10H13N3/c11-10-6-7-13(12-10)8-9-4-2-1-3-5-9/h2,4-7H,1,3,8H2,(H2,11,12) |
| InChIKey | ODTJVXMQCGAANZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(cyclohexa-1,5-dien-1-ylmethyl)pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexa-1,5-dien-1-ylmethyl)pyrazol-3-amine?
The IUPAC name of 1-(cyclohexa-1,5-dien-1-ylmethyl)pyrazol-3-amine (CID 67934717) is 1-(cyclohexa-1,5-dien-1-ylmethyl)pyrazol-3-amine.
What is the SMILES notation for 1-(cyclohexa-1,5-dien-1-ylmethyl)pyrazol-3-amine?
The canonical SMILES for 1-(cyclohexa-1,5-dien-1-ylmethyl)pyrazol-3-amine is Nc1ccn(CC2=CCCC=C2)n1.
What is the InChIKey of 1-(cyclohexa-1,5-dien-1-ylmethyl)pyrazol-3-amine?
The InChIKey is ODTJVXMQCGAANZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c11-10-6-7-13(12-10)8-9-4-2-1-3-5-9/h2,4-7H,1,3,8H2,(H2,11,12).
What are the key properties of 1-(cyclohexa-1,5-dien-1-ylmethyl)pyrazol-3-amine?
1-(cyclohexa-1,5-dien-1-ylmethyl)pyrazol-3-amine has a molecular weight of 175.24 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexa-1,5-dien-1-ylmethyl)pyrazol-3-amine is sourced from PubChem (CID 67934717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).