C28H32S — CID 67935167
2-ethylsulfanyl-6-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]naphthalene (PubChem CID 67935167) has the molecular formula C28H32S and a molecular weight of 400.63 g/mol. Its IUPAC name is 2-ethylsulfanyl-6-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]naphthalene.
| Compound Name | 2-ethylsulfanyl-6-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]naphthalene |
|---|---|
| PubChem CID | 67935167 |
| Molecular Formula | C28H32S |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 2-ethylsulfanyl-6-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]naphthalene |
| SMILES | CCSc1ccc2cc(C=Cc3ccc4c(c3)C(C)(C)CCC4(C)C)ccc2c1 |
| InChI | InChI=1S/C28H32S/c1-6-29-24-13-12-22-17-20(9-11-23(22)19-24)7-8-21-10-14-25-26(18-21)28(4,5)16-15-27(25,2)3/h7-14,17-19H,6,15-16H2,1-5H3 |
| InChIKey | YILDJCBPJOACAC-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|