C16H29N3O5S — CID 67935624
(4aR,8aR)-N,5-dipropyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]oxazolo[4,5-g]quinolin-2-amine;sulfuric acid (PubChem CID 67935624) has the molecular formula C16H29N3O5S and a molecular weight of 375.49 g/mol. Its IUPAC name is (4aR,8aR)-N,5-dipropyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]oxazolo[4,5-g]quinolin-2-amine;sulfuric acid.
| Compound Name | (4aR,8aR)-N,5-dipropyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]oxazolo[4,5-g]quinolin-2-amine;sulfuric acid |
|---|---|
| PubChem CID | 67935624 |
| Molecular Formula | C16H29N3O5S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (4aR,8aR)-N,5-dipropyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]oxazolo[4,5-g]quinolin-2-amine;sulfuric acid |
| SMILES | CCCNc1nc2c(o1)C[C@@H]1[C@H](CCCN1CCC)C2.O=S(=O)(O)O |
| InChI | InChI=1S/C16H27N3O.H2O4S/c1-3-7-17-16-18-13-10-12-6-5-9-19(8-4-2)14(12)11-15(13)20-16;1-5(2,3)4/h12,14H,3-11H2,1-2H3,(H,17,18);(H2,1,2,3,4)/t12-,14-;/m1./s1 |
| InChIKey | ZJLJOVVAHFCVRC-QMDUSEKHSA-N |
| XLogP | 2.43 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|