C11H19Cl2N3O — CID 67935687
(4aR,8aR)-5-methyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]oxazolo[4,5-g]quinolin-2-amine;dihydrochloride (PubChem CID 67935687) has the molecular formula C11H19Cl2N3O and a molecular weight of 280.20 g/mol. Its IUPAC name is (4aR,8aR)-5-methyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]oxazolo[4,5-g]quinolin-2-amine;dihydrochloride.
| Compound Name | (4aR,8aR)-5-methyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]oxazolo[4,5-g]quinolin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 67935687 |
| Molecular Formula | C11H19Cl2N3O |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (4aR,8aR)-5-methyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]oxazolo[4,5-g]quinolin-2-amine;dihydrochloride |
| SMILES | CN1CCC[C@@H]2Cc3nc(N)oc3C[C@H]21.Cl.Cl |
| InChI | InChI=1S/C11H17N3O.2ClH/c1-14-4-2-3-7-5-8-10(6-9(7)14)15-11(12)13-8;;/h7,9H,2-6H2,1H3,(H2,12,13);2*1H/t7-,9-;;/m1../s1 |
| InChIKey | OREKIZNTVXAUMC-QRUOIXDJSA-N |
| XLogP | 1.91 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |