C22H19Cl2N3O2 — CID 67936345
2-(chloromethyl)-6,8-dimethylquinoline;2-(chloromethyl)-6-nitroquinoline (PubChem CID 67936345) has the molecular formula C22H19Cl2N3O2 and a molecular weight of 428.32 g/mol. Its IUPAC name is 2-(chloromethyl)-6,8-dimethylquinoline;2-(chloromethyl)-6-nitroquinoline.
| Compound Name | 2-(chloromethyl)-6,8-dimethylquinoline;2-(chloromethyl)-6-nitroquinoline |
|---|---|
| PubChem CID | 67936345 |
| Molecular Formula | C22H19Cl2N3O2 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 2-(chloromethyl)-6,8-dimethylquinoline;2-(chloromethyl)-6-nitroquinoline |
| SMILES | Cc1cc(C)c2nc(CCl)ccc2c1.O=[N+]([O-])c1ccc2nc(CCl)ccc2c1 |
| InChI | InChI=1S/C12H12ClN.C10H7ClN2O2/c1-8-5-9(2)12-10(6-8)3-4-11(7-13)14-12;11-6-8-2-1-7-5-9(13(14)15)3-4-10(7)12-8/h3-6H,7H2,1-2H3;1-5H,6H2 |
| InChIKey | OEDYFNDEZGJTHQ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|