About imidazolidine-2,4-dione;pyrazolidin-3-one
imidazolidine-2,4-dione;pyrazolidin-3-one (PubChem CID 67936630) has the molecular formula C6H10N4O3
and a molecular weight of 186.17 g/mol. Its IUPAC name is imidazolidine-2,4-dione;pyrazolidin-3-one.
Molecular Properties
| Compound Name | imidazolidine-2,4-dione;pyrazolidin-3-one |
| PubChem CID | 67936630 |
| Molecular Formula | C6H10N4O3 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | imidazolidine-2,4-dione;pyrazolidin-3-one |
| SMILES | O=C1CCNN1.O=C1CNC(=O)N1 |
| InChI | InChI=1S/C3H4N2O2.C3H6N2O/c6-2-1-4-3(7)5-2;6-3-1-2-4-5-3/h1H2,(H2,4,5,6,7);4H,1-2H2,(H,5,6) |
| InChIKey | CENLSTQGKDKAAS-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze imidazolidine-2,4-dione;pyrazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazolidine-2,4-dione;pyrazolidin-3-one?
The IUPAC name of imidazolidine-2,4-dione;pyrazolidin-3-one (CID 67936630) is imidazolidine-2,4-dione;pyrazolidin-3-one.
What is the SMILES notation for imidazolidine-2,4-dione;pyrazolidin-3-one?
The canonical SMILES for imidazolidine-2,4-dione;pyrazolidin-3-one is O=C1CCNN1.O=C1CNC(=O)N1.
What is the InChIKey of imidazolidine-2,4-dione;pyrazolidin-3-one?
The InChIKey is CENLSTQGKDKAAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O2.C3H6N2O/c6-2-1-4-3(7)5-2;6-3-1-2-4-5-3/h1H2,(H2,4,5,6,7);4H,1-2H2,(H,5,6).
What are the key properties of imidazolidine-2,4-dione;pyrazolidin-3-one?
imidazolidine-2,4-dione;pyrazolidin-3-one has a molecular weight of 186.17 g/mol, XLogP of -2.16, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazolidine-2,4-dione;pyrazolidin-3-one is sourced from PubChem (CID 67936630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).