C31H37IN2O4S — CID 67936845
2-[(2R,3R)-3-acetyloxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]ethyl-dimethyl-[2-(3-methylphenyl)ethyl]azanium iodide (PubChem CID 67936845) has the molecular formula C31H37IN2O4S and a molecular weight of 660.62 g/mol. Its IUPAC name is 2-[(2R,3R)-3-acetyloxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]ethyl-dimethyl-[2-(3-methylphenyl)ethyl]azanium iodide.
| Compound Name | 2-[(2R,3R)-3-acetyloxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]ethyl-dimethyl-[2-(3-methylphenyl)ethyl]azanium iodide |
|---|---|
| PubChem CID | 67936845 |
| Molecular Formula | C31H37IN2O4S |
| Molecular Weight | 660.62 g/mol |
| Exact Mass | 660.15 |
| IUPAC Name | 2-[(2R,3R)-3-acetyloxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]ethyl-dimethyl-[2-(3-methylphenyl)ethyl]azanium iodide |
| SMILES | COc1ccc([C@@H]2Sc3ccccc3N(CC[N+](C)(C)CCc3cccc(C)c3)C(=O)[C@H]2OC(C)=O)cc1.[I-] |
| InChI | InChI=1S/C31H37N2O4S.HI/c1-22-9-8-10-24(21-22)17-19-33(3,4)20-18-32-27-11-6-7-12-28(27)38-30(29(31(32)35)37-23(2)34)25-13-15-26(36-5)16-14-25;/h6-16,21,29-30H,17-20H2,1-5H3;1H/q+1;/p-1/t29-,30-;/m0./s1 |
| InChIKey | FMLNEUUSEGTXOE-PNHSAAKESA-M |
| XLogP | 2.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.62 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|