C20H24O4 — CID 67936954
1-[4-(hydroxymethyl)phenyl]ethanone;1-[3-(1-hydroxypropyl)phenyl]ethanone (PubChem CID 67936954) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-[4-(hydroxymethyl)phenyl]ethanone;1-[3-(1-hydroxypropyl)phenyl]ethanone.
| Compound Name | 1-[4-(hydroxymethyl)phenyl]ethanone;1-[3-(1-hydroxypropyl)phenyl]ethanone |
|---|---|
| PubChem CID | 67936954 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 1-[4-(hydroxymethyl)phenyl]ethanone;1-[3-(1-hydroxypropyl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(CO)cc1.CCC(O)c1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C11H14O2.C9H10O2/c1-3-11(13)10-6-4-5-9(7-10)8(2)12;1-7(11)9-4-2-8(6-10)3-5-9/h4-7,11,13H,3H2,1-2H3;2-5,10H,6H2,1H3 |
| InChIKey | SBCAKEPYWWNNPE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |