C15H19NO5 — CID 67937297
ethyl 2,3-dimethoxy-4-(3-oxopyrrolidin-1-yl)benzoate (PubChem CID 67937297) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is ethyl 2,3-dimethoxy-4-(3-oxopyrrolidin-1-yl)benzoate.
| Compound Name | ethyl 2,3-dimethoxy-4-(3-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 67937297 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | ethyl 2,3-dimethoxy-4-(3-oxopyrrolidin-1-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCC(=O)C2)c(OC)c1OC |
| InChI | InChI=1S/C15H19NO5/c1-4-21-15(18)11-5-6-12(14(20-3)13(11)19-2)16-8-7-10(17)9-16/h5-6H,4,7-9H2,1-3H3 |
| InChIKey | AUYCXBTZVJKMAK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |