C22H40N2O5 — CID 67937423
tert-butyl N-[(2S,3S)-1-cyclohexyl-3,4-dihydroxy-5-(2-methylpropylcarbamoyl)hex-5-en-2-yl]carbamate (PubChem CID 67937423) has the molecular formula C22H40N2O5 and a molecular weight of 412.57 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-1-cyclohexyl-3,4-dihydroxy-5-(2-methylpropylcarbamoyl)hex-5-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-1-cyclohexyl-3,4-dihydroxy-5-(2-methylpropylcarbamoyl)hex-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 67937423 |
| Molecular Formula | C22H40N2O5 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.29 |
| IUPAC Name | tert-butyl N-[(2S,3S)-1-cyclohexyl-3,4-dihydroxy-5-(2-methylpropylcarbamoyl)hex-5-en-2-yl]carbamate |
| SMILES | C=C(C(=O)NCC(C)C)C(O)[C@@H](O)[C@H](CC1CCCCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H40N2O5/c1-14(2)13-23-20(27)15(3)18(25)19(26)17(12-16-10-8-7-9-11-16)24-21(28)29-22(4,5)6/h14,16-19,25-26H,3,7-13H2,1-2,4-6H3,(H,23,27)(H,24,28)/t17-,18?,19-/m0/s1 |
| InChIKey | DKCHFSWUQSDEHJ-JVUMBYKBSA-N |
| XLogP | 2.90 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|