C18H21N5O4S — CID 67937488
6-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfonylamino]-5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 67937488) has the molecular formula C18H21N5O4S and a molecular weight of 403.46 g/mol. Its IUPAC name is 6-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfonylamino]-5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfonylamino]-5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 67937488 |
| Molecular Formula | C18H21N5O4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 6-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfonylamino]-5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | C/C=C\C1(NS(=O)(=O)c2nc3nc(C)cc(C)n3n2)C(C)=CC=CC1C(=O)O |
| InChI | InChI=1S/C18H21N5O4S/c1-5-9-18(11(2)7-6-8-14(18)15(24)25)22-28(26,27)17-20-16-19-12(3)10-13(4)23(16)21-17/h5-10,14,22H,1-4H3,(H,24,25)/b9-5- |
| InChIKey | VIOLIZJMRYQIAP-UITAMQMPSA-N |
| XLogP | 1.55 |
| TPSA | 126.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|