About cobalt;bis(6-(propylaminomethylidene)cyclohexa-2,4-dien-1-one)
cobalt;bis(6-(propylaminomethylidene)cyclohexa-2,4-dien-1-one) (PubChem CID 6793756) has the molecular formula C20H26CoN2O2
and a molecular weight of 385.37 g/mol. Its IUPAC name is cobalt;bis(6-(propylaminomethylidene)cyclohexa-2,4-dien-1-one).
Molecular Properties
| Compound Name | cobalt;bis(6-(propylaminomethylidene)cyclohexa-2,4-dien-1-one) |
| PubChem CID | 6793756 |
| Molecular Formula | C20H26CoN2O2 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | cobalt;bis(6-(propylaminomethylidene)cyclohexa-2,4-dien-1-one) |
| SMILES | CCCNC=C1C=CC=CC1=O.CCCNC=C1C=CC=CC1=O.[Co] |
| InChI | InChI=1S/2C10H13NO.Co/c2*1-2-7-11-8-9-5-3-4-6-10(9)12;/h2*3-6,8,11H,2,7H2,1H3; |
| InChIKey | NHVNVMHBHNSYOC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cobalt;bis(6-(propylaminomethylidene)cyclohexa-2,4-dien-1-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;bis(6-(propylaminomethylidene)cyclohexa-2,4-dien-1-one)?
The IUPAC name of cobalt;bis(6-(propylaminomethylidene)cyclohexa-2,4-dien-1-one) (CID 6793756) is cobalt;bis(6-(propylaminomethylidene)cyclohexa-2,4-dien-1-one).
What is the SMILES notation for cobalt;bis(6-(propylaminomethylidene)cyclohexa-2,4-dien-1-one)?
The canonical SMILES for cobalt;bis(6-(propylaminomethylidene)cyclohexa-2,4-dien-1-one) is CCCNC=C1C=CC=CC1=O.CCCNC=C1C=CC=CC1=O.[Co].
What is the InChIKey of cobalt;bis(6-(propylaminomethylidene)cyclohexa-2,4-dien-1-one)?
The InChIKey is NHVNVMHBHNSYOC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H13NO.Co/c2*1-2-7-11-8-9-5-3-4-6-10(9)12;/h2*3-6,8,11H,2,7H2,1H3;.
What are the key properties of cobalt;bis(6-(propylaminomethylidene)cyclohexa-2,4-dien-1-one)?
cobalt;bis(6-(propylaminomethylidene)cyclohexa-2,4-dien-1-one) has a molecular weight of 385.37 g/mol, XLogP of 3.13, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;bis(6-(propylaminomethylidene)cyclohexa-2,4-dien-1-one) is sourced from PubChem (CID 6793756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).