C15H19N3O — CID 67937781
2-but-1-enyl-7,7-dimethyl-1,2,3,5-tetrahydropyrrolo[2,3-f]benzimidazol-6-one (PubChem CID 67937781) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-but-1-enyl-7,7-dimethyl-1,2,3,5-tetrahydropyrrolo[2,3-f]benzimidazol-6-one.
| Compound Name | 2-but-1-enyl-7,7-dimethyl-1,2,3,5-tetrahydropyrrolo[2,3-f]benzimidazol-6-one |
|---|---|
| PubChem CID | 67937781 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 2-but-1-enyl-7,7-dimethyl-1,2,3,5-tetrahydropyrrolo[2,3-f]benzimidazol-6-one |
| SMILES | CCC=CC1Nc2cc3c(cc2N1)C(C)(C)C(=O)N3 |
| InChI | InChI=1S/C15H19N3O/c1-4-5-6-13-16-11-7-9-10(8-12(11)17-13)18-14(19)15(9,2)3/h5-8,13,16-17H,4H2,1-3H3,(H,18,19) |
| InChIKey | VJTSVKPVQLHACS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|