C13H17BrClNO2 — CID 67937791
(4aR,10bS)-10-bromo-4-methyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridin-7-ol;hydrochloride (PubChem CID 67937791) has the molecular formula C13H17BrClNO2 and a molecular weight of 334.64 g/mol. Its IUPAC name is (4aR,10bS)-10-bromo-4-methyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridin-7-ol;hydrochloride.
| Compound Name | (4aR,10bS)-10-bromo-4-methyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridin-7-ol;hydrochloride |
|---|---|
| PubChem CID | 67937791 |
| Molecular Formula | C13H17BrClNO2 |
| Molecular Weight | 334.64 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | (4aR,10bS)-10-bromo-4-methyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridin-7-ol;hydrochloride |
| SMILES | CN1CCC[C@H]2c3c(Br)ccc(O)c3OC[C@@H]21.Cl |
| InChI | InChI=1S/C13H16BrNO2.ClH/c1-15-6-2-3-8-10(15)7-17-13-11(16)5-4-9(14)12(8)13;/h4-5,8,10,16H,2-3,6-7H2,1H3;1H/t8-,10+;/m1./s1 |
| InChIKey | JQNBLXZFMNHCFZ-SCYNACPDSA-N |
| XLogP | 3.15 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.64 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |